C16H19ClN2O3 — CID 57110169
1-(4-butyl-3-chlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea (PubChem CID 57110169) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 1-(4-butyl-3-chlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea.
| Compound Name | 1-(4-butyl-3-chlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea |
|---|---|
| PubChem CID | 57110169 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(4-butyl-3-chlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea |
| SMILES | CCCCc1ccc(NC(=O)NC2=CC(=O)OCC2)cc1Cl |
| InChI | InChI=1S/C16H19ClN2O3/c1-2-3-4-11-5-6-12(9-14(11)17)18-16(21)19-13-7-8-22-15(20)10-13/h5-6,9-10H,2-4,7-8H2,1H3,(H2,18,19,21) |
| InChIKey | KENWBLLOXJIYAD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |