C12H10Cl2N2O3 — CID 139933614
1-(3,4-dichlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea (PubChem CID 139933614) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea |
|---|---|
| PubChem CID | 139933614 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(6-oxo-2,3-dihydropyran-4-yl)urea |
| SMILES | O=C(NC1=CC(=O)OCC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O3/c13-9-2-1-7(5-10(9)14)15-12(18)16-8-3-4-19-11(17)6-8/h1-2,5-6H,3-4H2,(H2,15,16,18) |
| InChIKey | JWZLUSPZACQXAW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |