C16H23NO5S — CID 57111873
2-[[(6S)-2-(3,3-dimethylbutanoyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]oxy]ethyl acetate (PubChem CID 57111873) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[[(6S)-2-(3,3-dimethylbutanoyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]oxy]ethyl acetate.
| Compound Name | 2-[[(6S)-2-(3,3-dimethylbutanoyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]oxy]ethyl acetate |
|---|---|
| PubChem CID | 57111873 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[[(6S)-2-(3,3-dimethylbutanoyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]oxy]ethyl acetate |
| SMILES | CC(=O)OCCOC1=C(C(=O)CC(C)(C)C)N2C(=O)C[C@@H]2SC1 |
| InChI | InChI=1S/C16H23NO5S/c1-10(18)21-5-6-22-12-9-23-14-7-13(20)17(14)15(12)11(19)8-16(2,3)4/h14H,5-9H2,1-4H3/t14-/m0/s1 |
| InChIKey | YFKCPZGRFQVWHY-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|