About (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide
(6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide (PubChem CID 70522482) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide.
Molecular Properties
| Compound Name | (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide |
| PubChem CID | 70522482 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide |
| SMILES | CC1=C(C(=O)O)N2C(=O)C[C@@H]2SC1.NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C8H9NO3S.C8H9NO2/c1-4-3-13-6-2-5(10)9(6)7(4)8(11)12;9-8(10)6-11-7-4-2-1-3-5-7/h6H,2-3H2,1H3,(H,11,12);1-5H,6H2,(H2,9,10)/t6-;/m0./s1 |
| InChIKey | AVZUNNVWEONUCI-RGMNGODLSA-N |
| XLogP | 1.20 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide?
The IUPAC name of (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide (CID 70522482) is (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide.
What is the SMILES notation for (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide?
The canonical SMILES for (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide is CC1=C(C(=O)O)N2C(=O)C[C@@H]2SC1.NC(=O)COc1ccccc1.
What is the InChIKey of (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide?
The InChIKey is AVZUNNVWEONUCI-RGMNGODLSA-N. The full InChI is InChI=1S/C8H9NO3S.C8H9NO2/c1-4-3-13-6-2-5(10)9(6)7(4)8(11)12;9-8(10)6-11-7-4-2-1-3-5-7/h6H,2-3H2,1H3,(H,11,12);1-5H,6H2,(H2,9,10)/t6-;/m0./s1.
What are the key properties of (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide?
(6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide has a molecular weight of 350.40 g/mol, XLogP of 1.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2-phenoxyacetamide is sourced from PubChem (CID 70522482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).