C18H27BO — CID 57112013
CID 57112013 (PubChem CID 57112013) has the molecular formula C18H27BO and a molecular weight of 270.22 g/mol.
| Compound Name | CID 57112013 |
|---|---|
| PubChem CID | 57112013 |
| Molecular Formula | C18H27BO |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | — |
| SMILES | [B]C1C(C=O)CC[C@H]2C1CC[C@H]1[C@@H]3CCC[C@H]3CC[C@@H]12 |
| InChI | InChI=1S/C18H27BO/c19-18-12(10-20)5-7-16-15-6-4-11-2-1-3-13(11)14(15)8-9-17(16)18/h10-18H,1-9H2/t11-,12?,13+,14-,15-,16+,17?,18?/m0/s1 |
| InChIKey | UUPVNVAIUMYSEU-SVHRMLOLSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|