C17H26O2 — CID 91534359
(3aR,3bS,9aS,9bS,11aS)-1,2,3,3a,3b,4,5,5a,6,7,9,9a,9b,10,11,11a-hexadecahydroindeno[4,5-h]isochromene-7-carbaldehyde (PubChem CID 91534359) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (3aR,3bS,9aS,9bS,11aS)-1,2,3,3a,3b,4,5,5a,6,7,9,9a,9b,10,11,11a-hexadecahydroindeno[4,5-h]isochromene-7-carbaldehyde.
| Compound Name | (3aR,3bS,9aS,9bS,11aS)-1,2,3,3a,3b,4,5,5a,6,7,9,9a,9b,10,11,11a-hexadecahydroindeno[4,5-h]isochromene-7-carbaldehyde |
|---|---|
| PubChem CID | 91534359 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (3aR,3bS,9aS,9bS,11aS)-1,2,3,3a,3b,4,5,5a,6,7,9,9a,9b,10,11,11a-hexadecahydroindeno[4,5-h]isochromene-7-carbaldehyde |
| SMILES | O=CC1CC2CC[C@H]3[C@@H]4CCC[C@H]4CC[C@@H]3[C@H]2CO1 |
| InChI | InChI=1S/C17H26O2/c18-9-13-8-12-5-7-15-14-3-1-2-11(14)4-6-16(15)17(12)10-19-13/h9,11-17H,1-8,10H2/t11-,12?,13?,14+,15-,16-,17-/m0/s1 |
| InChIKey | SITXTFPXSGGRAG-ZTZDZXKLSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|