C30H24N2O4S — CID 57112633
2-ethenyl-N-[4-[4-[(2-ethenylbenzoyl)amino]phenyl]sulfonylphenyl]benzamide (PubChem CID 57112633) has the molecular formula C30H24N2O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is 2-ethenyl-N-[4-[4-[(2-ethenylbenzoyl)amino]phenyl]sulfonylphenyl]benzamide.
| Compound Name | 2-ethenyl-N-[4-[4-[(2-ethenylbenzoyl)amino]phenyl]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 57112633 |
| Molecular Formula | C30H24N2O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-ethenyl-N-[4-[4-[(2-ethenylbenzoyl)amino]phenyl]sulfonylphenyl]benzamide |
| SMILES | C=Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(=O)c3ccccc3C=C)cc2)cc1 |
| InChI | InChI=1S/C30H24N2O4S/c1-3-21-9-5-7-11-27(21)29(33)31-23-13-17-25(18-14-23)37(35,36)26-19-15-24(16-20-26)32-30(34)28-12-8-6-10-22(28)4-2/h3-20H,1-2H2,(H,31,33)(H,32,34) |
| InChIKey | GQLRTDQPYCIHBS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |