C21H30N2O — CID 57114040
N-[3-(dimethylamino)propoxy]-3,3-dimethyl-5-(1-phenylethenyl)cyclohexa-1,5-dien-1-amine (PubChem CID 57114040) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-[3-(dimethylamino)propoxy]-3,3-dimethyl-5-(1-phenylethenyl)cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[3-(dimethylamino)propoxy]-3,3-dimethyl-5-(1-phenylethenyl)cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 57114040 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-[3-(dimethylamino)propoxy]-3,3-dimethyl-5-(1-phenylethenyl)cyclohexa-1,5-dien-1-amine |
| SMILES | C=C(C1=CC(NOCCCN(C)C)=CC(C)(C)C1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O/c1-17(18-10-7-6-8-11-18)19-14-20(16-21(2,3)15-19)22-24-13-9-12-23(4)5/h6-8,10-11,14,16,22H,1,9,12-13,15H2,2-5H3 |
| InChIKey | LPJZZKWBQXLZQZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|