C14H14N2 — CID 57114855
5,5-dimethyl-3H-1,10-phenanthroline (PubChem CID 57114855) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5,5-dimethyl-3H-1,10-phenanthroline.
| Compound Name | 5,5-dimethyl-3H-1,10-phenanthroline |
|---|---|
| PubChem CID | 57114855 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5,5-dimethyl-3H-1,10-phenanthroline |
| SMILES | CC1(C)C=c2cccnc2=C2N=CCC=C21 |
| InChI | InChI=1S/C14H14N2/c1-14(2)9-10-5-3-7-15-12(10)13-11(14)6-4-8-16-13/h3,5-9H,4H2,1-2H3 |
| InChIKey | YJQVNBWHNJSZFP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |