C12H15N — CID 89038768
3,6,6-trimethyl-7H-isoquinoline (PubChem CID 89038768) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,6,6-trimethyl-7H-isoquinoline.
| Compound Name | 3,6,6-trimethyl-7H-isoquinoline |
|---|---|
| PubChem CID | 89038768 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3,6,6-trimethyl-7H-isoquinoline |
| SMILES | Cc1cc2c(cn1)=CCC(C)(C)C=2 |
| InChI | InChI=1S/C12H15N/c1-9-6-11-7-12(2,3)5-4-10(11)8-13-9/h4,6-8H,5H2,1-3H3 |
| InChIKey | CXYHSHJUGKWRCC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |