C17H26N2O4 — CID 57120164
1-[9-(2,5-dihydroxypyrrol-1-yl)nonyl]pyrrole-2,5-diol (PubChem CID 57120164) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[9-(2,5-dihydroxypyrrol-1-yl)nonyl]pyrrole-2,5-diol.
| Compound Name | 1-[9-(2,5-dihydroxypyrrol-1-yl)nonyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 57120164 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[9-(2,5-dihydroxypyrrol-1-yl)nonyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C17H26N2O4/c20-14-8-9-15(21)18(14)12-6-4-2-1-3-5-7-13-19-16(22)10-11-17(19)23/h8-11,20-23H,1-7,12-13H2 |
| InChIKey | LIEDVSRNHKLRBG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|