C13H17NO2 — CID 57121253
3,4-dihydro-1H-isoquinolin-2-yl butanoate (PubChem CID 57121253) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl butanoate.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl butanoate |
|---|---|
| PubChem CID | 57121253 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl butanoate |
| SMILES | CCCC(=O)ON1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO2/c1-2-5-13(15)16-14-9-8-11-6-3-4-7-12(11)10-14/h3-4,6-7H,2,5,8-10H2,1H3 |
| InChIKey | ABHZRLZNFICNMH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |