About 4-iminobutyl prop-2-enoate
4-iminobutyl prop-2-enoate (PubChem CID 57122491) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-iminobutyl prop-2-enoate.
Molecular Properties
| Compound Name | 4-iminobutyl prop-2-enoate |
| PubChem CID | 57122491 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 4-iminobutyl prop-2-enoate |
| SMILES | [H]/N=C/CCCOC(=O)C=C |
| InChI | InChI=1S/C7H11NO2/c1-2-7(9)10-6-4-3-5-8/h2,5,8H,1,3-4,6H2/b8-5+ |
| InChIKey | CZHKZPAFUACZHW-VMPITWQZSA-N |
| XLogP | 1.15 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminobutyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminobutyl prop-2-enoate?
The IUPAC name of 4-iminobutyl prop-2-enoate (CID 57122491) is 4-iminobutyl prop-2-enoate.
What is the SMILES notation for 4-iminobutyl prop-2-enoate?
The canonical SMILES for 4-iminobutyl prop-2-enoate is [H]/N=C/CCCOC(=O)C=C.
What is the InChIKey of 4-iminobutyl prop-2-enoate?
The InChIKey is CZHKZPAFUACZHW-VMPITWQZSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-7(9)10-6-4-3-5-8/h2,5,8H,1,3-4,6H2/b8-5+.
What are the key properties of 4-iminobutyl prop-2-enoate?
4-iminobutyl prop-2-enoate has a molecular weight of 141.17 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminobutyl prop-2-enoate is sourced from PubChem (CID 57122491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).