C32H62O2Si — CID 57124846
trimethyl-[2-(2-oct-7-enoxyethyl)-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]silane (PubChem CID 57124846) has the molecular formula C32H62O2Si and a molecular weight of 506.93 g/mol. Its IUPAC name is trimethyl-[2-(2-oct-7-enoxyethyl)-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]silane.
| Compound Name | trimethyl-[2-(2-oct-7-enoxyethyl)-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]silane |
|---|---|
| PubChem CID | 57124846 |
| Molecular Formula | C32H62O2Si |
| Molecular Weight | 506.93 g/mol |
| Exact Mass | 506.45 |
| IUPAC Name | trimethyl-[2-(2-oct-7-enoxyethyl)-6-[(1S,2S)-2-oct-1-enylcyclopentyl]hexoxy]silane |
| SMILES | C=CCCCCCCOCCC(CCCC[C@H]1CCC[C@@H]1C=CCCCCCC)CO[Si](C)(C)C |
| InChI | InChI=1S/C32H62O2Si/c1-6-8-10-12-14-16-22-31-24-20-25-32(31)23-18-17-21-30(29-34-35(3,4)5)26-28-33-27-19-15-13-11-9-7-2/h7,16,22,30-32H,2,6,8-15,17-21,23-29H2,1,3-5H3/t30?,31-,32-/m0/s1 |
| InChIKey | KCMNPUHCLLBRCE-ZPQRHCBNSA-N |
| XLogP | 10.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.93 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|