C18H19N3O4 — CID 57125967
[4-[[(5,6-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]methanediol (PubChem CID 57125967) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is [4-[[(5,6-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]methanediol.
| Compound Name | [4-[[(5,6-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]methanediol |
|---|---|
| PubChem CID | 57125967 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [4-[[(5,6-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]methanediol |
| SMILES | COc1ccc2ncnc(NCc3ccc(C(O)O)cc3)c2c1OC |
| InChI | InChI=1S/C18H19N3O4/c1-24-14-8-7-13-15(16(14)25-2)17(21-10-20-13)19-9-11-3-5-12(6-4-11)18(22)23/h3-8,10,18,22-23H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | VKBYIDQKYZVWCZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|