C10H17N5S — CID 57133698
1-(2-amino-4-pyrazin-2-ylbutyl)-3-methylthiourea (PubChem CID 57133698) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is 1-(2-amino-4-pyrazin-2-ylbutyl)-3-methylthiourea.
| Compound Name | 1-(2-amino-4-pyrazin-2-ylbutyl)-3-methylthiourea |
|---|---|
| PubChem CID | 57133698 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-(2-amino-4-pyrazin-2-ylbutyl)-3-methylthiourea |
| SMILES | CNC(=S)NCC(N)CCc1cnccn1 |
| InChI | InChI=1S/C10H17N5S/c1-12-10(16)15-6-8(11)2-3-9-7-13-4-5-14-9/h4-5,7-8H,2-3,6,11H2,1H3,(H2,12,15,16) |
| InChIKey | UZFIJHYSSUDRBF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|