C12H19NO5 — CID 57135983
(1-carbamoylcyclohexyl) 1,3-dioxane-5-carboxylate (PubChem CID 57135983) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 1,3-dioxane-5-carboxylate.
| Compound Name | (1-carbamoylcyclohexyl) 1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 57135983 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (1-carbamoylcyclohexyl) 1,3-dioxane-5-carboxylate |
| SMILES | NC(=O)C1(OC(=O)C2COCOC2)CCCCC1 |
| InChI | InChI=1S/C12H19NO5/c13-11(15)12(4-2-1-3-5-12)18-10(14)9-6-16-8-17-7-9/h9H,1-8H2,(H2,13,15) |
| InChIKey | SPBNWIGYRXPKPC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |