C13H15NO4 — CID 82131293
1-(1,3-benzodioxol-5-yloxy)cyclopentane-1-carboxamide (PubChem CID 82131293) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yloxy)cyclopentane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yloxy)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 82131293 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yloxy)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(Oc2ccc3c(c2)OCO3)CCCC1 |
| InChI | InChI=1S/C13H15NO4/c14-12(15)13(5-1-2-6-13)18-9-3-4-10-11(7-9)17-8-16-10/h3-4,7H,1-2,5-6,8H2,(H2,14,15) |
| InChIKey | VGNPHULJGMZJNB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |