C22H28N2O6 — CID 174547765
bis(1-carbamoylcyclohexyl) benzene-1,4-dicarboxylate (PubChem CID 174547765) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is bis(1-carbamoylcyclohexyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(1-carbamoylcyclohexyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174547765 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | bis(1-carbamoylcyclohexyl) benzene-1,4-dicarboxylate |
| SMILES | NC(=O)C1(OC(=O)c2ccc(C(=O)OC3(C(N)=O)CCCCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C22H28N2O6/c23-19(27)21(11-3-1-4-12-21)29-17(25)15-7-9-16(10-8-15)18(26)30-22(20(24)28)13-5-2-6-14-22/h7-10H,1-6,11-14H2,(H2,23,27)(H2,24,28) |
| InChIKey | JRBUGXXJOAPGDG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |