C15H18N4O — CID 57139095
[(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]urea (PubChem CID 57139095) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is [(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]urea.
| Compound Name | [(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]urea |
|---|---|
| PubChem CID | 57139095 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]urea |
| SMILES | NC(=O)Nn1cc2c3c(cccc31)[C@H]1CCCN[C@@H]1C2 |
| InChI | InChI=1S/C15H18N4O/c16-15(20)18-19-8-9-7-12-10(4-2-6-17-12)11-3-1-5-13(19)14(9)11/h1,3,5,8,10,12,17H,2,4,6-7H2,(H3,16,18,20)/t10-,12-/m1/s1 |
| InChIKey | FRIPFEFSCGBKOD-ZYHUDNBSSA-N |
| XLogP | 1.66 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |