C15H18N4OS — CID 88599822
[(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]sulfanylurea (PubChem CID 88599822) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is [(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]sulfanylurea.
| Compound Name | [(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]sulfanylurea |
|---|---|
| PubChem CID | 88599822 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-4-yl]sulfanylurea |
| SMILES | NC(=O)NSn1cc2c3c(cccc31)[C@H]1CCCN[C@@H]1C2 |
| InChI | InChI=1S/C15H18N4OS/c16-15(20)18-21-19-8-9-7-12-10(4-2-6-17-12)11-3-1-5-13(19)14(9)11/h1,3,5,8,10,12,17H,2,4,6-7H2,(H3,16,18,20)/t10-,12-/m1/s1 |
| InChIKey | RLKKXSPBHDLVEP-ZYHUDNBSSA-N |
| XLogP | 2.11 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|