C21H44N8 — CID 57147862
1-[1,1,2-tri(piperazin-1-yl)pentan-2-yl]piperazine (PubChem CID 57147862) has the molecular formula C21H44N8 and a molecular weight of 408.64 g/mol. Its IUPAC name is 1-[1,1,2-tri(piperazin-1-yl)pentan-2-yl]piperazine.
| Compound Name | 1-[1,1,2-tri(piperazin-1-yl)pentan-2-yl]piperazine |
|---|---|
| PubChem CID | 57147862 |
| Molecular Formula | C21H44N8 |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.37 |
| IUPAC Name | 1-[1,1,2-tri(piperazin-1-yl)pentan-2-yl]piperazine |
| SMILES | CCCC(C(N1CCNCC1)N1CCNCC1)(N1CCNCC1)N1CCNCC1 |
| InChI | InChI=1S/C21H44N8/c1-2-3-21(28-16-8-24-9-17-28,29-18-10-25-11-19-29)20(26-12-4-22-5-13-26)27-14-6-23-7-15-27/h20,22-25H,2-19H2,1H3 |
| InChIKey | FSPSBLYNKIINCS-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |