C30H45N3O3 — CID 57152110
3,5-ditert-butyl-N-[[2-(heptylcarbamoylamino)phenyl]methyl]-4-hydroxybenzamide (PubChem CID 57152110) has the molecular formula C30H45N3O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[[2-(heptylcarbamoylamino)phenyl]methyl]-4-hydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N-[[2-(heptylcarbamoylamino)phenyl]methyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 57152110 |
| Molecular Formula | C30H45N3O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | 3,5-ditert-butyl-N-[[2-(heptylcarbamoylamino)phenyl]methyl]-4-hydroxybenzamide |
| SMILES | CCCCCCCNC(=O)Nc1ccccc1CNC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H45N3O3/c1-8-9-10-11-14-17-31-28(36)33-25-16-13-12-15-21(25)20-32-27(35)22-18-23(29(2,3)4)26(34)24(19-22)30(5,6)7/h12-13,15-16,18-19,34H,8-11,14,17,20H2,1-7H3,(H,32,35)(H2,31,33,36) |
| InChIKey | FJMYJMAWAWPWLE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|