About 4-ethyl-1,2,3-benzothiadiazole
4-ethyl-1,2,3-benzothiadiazole (PubChem CID 57153328) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 4-ethyl-1,2,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4-ethyl-1,2,3-benzothiadiazole |
| PubChem CID | 57153328 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 4-ethyl-1,2,3-benzothiadiazole |
| SMILES | CCc1cccc2snnc12 |
| InChI | InChI=1S/C8H8N2S/c1-2-6-4-3-5-7-8(6)9-10-11-7/h3-5H,2H2,1H3 |
| InChIKey | LXFJLHGJFKWEMY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1,2,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2,3-benzothiadiazole?
The IUPAC name of 4-ethyl-1,2,3-benzothiadiazole (CID 57153328) is 4-ethyl-1,2,3-benzothiadiazole.
What is the SMILES notation for 4-ethyl-1,2,3-benzothiadiazole?
The canonical SMILES for 4-ethyl-1,2,3-benzothiadiazole is CCc1cccc2snnc12.
What is the InChIKey of 4-ethyl-1,2,3-benzothiadiazole?
The InChIKey is LXFJLHGJFKWEMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c1-2-6-4-3-5-7-8(6)9-10-11-7/h3-5H,2H2,1H3.
What are the key properties of 4-ethyl-1,2,3-benzothiadiazole?
4-ethyl-1,2,3-benzothiadiazole has a molecular weight of 164.23 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2,3-benzothiadiazole is sourced from PubChem (CID 57153328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).