C26H28O — CID 57157083
(8R,9S,10R,11S,13S,14S)-13-methyl-11-(2-phenylethynyl)-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57157083) has the molecular formula C26H28O and a molecular weight of 356.51 g/mol. Its IUPAC name is (8R,9S,10R,11S,13S,14S)-13-methyl-11-(2-phenylethynyl)-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,11S,13S,14S)-13-methyl-11-(2-phenylethynyl)-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57157083 |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (8R,9S,10R,11S,13S,14S)-13-methyl-11-(2-phenylethynyl)-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C=CC3=CC(=O)CC[C@@H]3[C@H]1[C@@H](C#Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H28O/c1-26-15-5-8-24(26)23-13-11-19-16-21(27)12-14-22(19)25(23)20(17-26)10-9-18-6-3-2-4-7-18/h2-4,6-7,11,13,16,20,22-25H,5,8,12,14-15,17H2,1H3/t20-,22-,23-,24-,25+,26-/m0/s1 |
| InChIKey | HBSDWHGSOHSQPU-XORQXOLISA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|