C19H14F5NO3 — CID 57165872
3-(2,4-difluorophenyl)imino-2-(3,4,6-trifluoro-2-methylbenzoyl)pentanoic acid (PubChem CID 57165872) has the molecular formula C19H14F5NO3 and a molecular weight of 399.32 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)imino-2-(3,4,6-trifluoro-2-methylbenzoyl)pentanoic acid.
| Compound Name | 3-(2,4-difluorophenyl)imino-2-(3,4,6-trifluoro-2-methylbenzoyl)pentanoic acid |
|---|---|
| PubChem CID | 57165872 |
| Molecular Formula | C19H14F5NO3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 3-(2,4-difluorophenyl)imino-2-(3,4,6-trifluoro-2-methylbenzoyl)pentanoic acid |
| SMILES | CC/C(=N\c1ccc(F)cc1F)C(C(=O)O)C(=O)c1c(F)cc(F)c(F)c1C |
| InChI | InChI=1S/C19H14F5NO3/c1-3-13(25-14-5-4-9(20)6-10(14)21)16(19(27)28)18(26)15-8(2)17(24)12(23)7-11(15)22/h4-7,16H,3H2,1-2H3,(H,27,28)/b25-13+ |
| InChIKey | KLYQJEWWXKXWMA-DHRITJCHSA-N |
| XLogP | 4.76 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|