C29H33F3N2O3 — CID 57167381
N-[8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 57167381) has the molecular formula C29H33F3N2O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-[8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 57167381 |
| Molecular Formula | C29H33F3N2O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | N-[8-hydroxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)CC(NC(=O)C=Cc3cccc(C(F)(F)F)c3)CC(O)C2C1 |
| InChI | InChI=1S/C29H33F3N2O3/c1-3-13-34-14-12-28(21-7-5-9-24(16-21)37-2)18-23(17-26(35)25(28)19-34)33-27(36)11-10-20-6-4-8-22(15-20)29(30,31)32/h3-11,15-16,23,25-26,35H,1,12-14,17-19H2,2H3,(H,33,36) |
| InChIKey | PSIQPUHTCZZSMJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|