C13H17Br2NOS — CID 57173149
S-phenyl N-(2,3-dibromopropyl)-N-propylcarbamothioate (PubChem CID 57173149) has the molecular formula C13H17Br2NOS and a molecular weight of 395.16 g/mol. Its IUPAC name is S-phenyl N-(2,3-dibromopropyl)-N-propylcarbamothioate.
| Compound Name | S-phenyl N-(2,3-dibromopropyl)-N-propylcarbamothioate |
|---|---|
| PubChem CID | 57173149 |
| Molecular Formula | C13H17Br2NOS |
| Molecular Weight | 395.16 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | S-phenyl N-(2,3-dibromopropyl)-N-propylcarbamothioate |
| SMILES | CCCN(CC(Br)CBr)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C13H17Br2NOS/c1-2-8-16(10-11(15)9-14)13(17)18-12-6-4-3-5-7-12/h3-7,11H,2,8-10H2,1H3 |
| InChIKey | XCDFDWYRRLUOEI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.16 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|