C17H23NO4 — CID 57176427
5-(3,4-dimethoxyphenyl)-3-(1H-pyrrol-2-yl)pentane-1,2-diol (PubChem CID 57176427) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-(1H-pyrrol-2-yl)pentane-1,2-diol.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-(1H-pyrrol-2-yl)pentane-1,2-diol |
|---|---|
| PubChem CID | 57176427 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-(1H-pyrrol-2-yl)pentane-1,2-diol |
| SMILES | COc1ccc(CCC(c2ccc[nH]2)C(O)CO)cc1OC |
| InChI | InChI=1S/C17H23NO4/c1-21-16-8-6-12(10-17(16)22-2)5-7-13(15(20)11-19)14-4-3-9-18-14/h3-4,6,8-10,13,15,18-20H,5,7,11H2,1-2H3 |
| InChIKey | GCIVXIQVHJGQBY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |