C27H30N4O4S — CID 57176492
ethyl 6-methyl-3-[[methyl(1-phenylpropan-2-yl)amino]methyl]-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 57176492) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is ethyl 6-methyl-3-[[methyl(1-phenylpropan-2-yl)amino]methyl]-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 6-methyl-3-[[methyl(1-phenylpropan-2-yl)amino]methyl]-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 57176492 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | ethyl 6-methyl-3-[[methyl(1-phenylpropan-2-yl)amino]methyl]-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1C(C)=Nc2snc(CN(C)C(C)Cc3ccccc3)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N4O4S/c1-5-35-27(32)23-18(3)28-26-25(24(23)20-12-9-13-21(15-20)31(33)34)22(29-36-26)16-30(4)17(2)14-19-10-7-6-8-11-19/h6-13,15,17,23-24H,5,14,16H2,1-4H3 |
| InChIKey | IATPHGMUHSGBCH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|