C27H27N3O7S — CID 57026799
ethyl 3-[2-(2-methoxy-2-phenylacetyl)oxyethyl]-6-methyl-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 57026799) has the molecular formula C27H27N3O7S and a molecular weight of 537.59 g/mol. Its IUPAC name is ethyl 3-[2-(2-methoxy-2-phenylacetyl)oxyethyl]-6-methyl-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 3-[2-(2-methoxy-2-phenylacetyl)oxyethyl]-6-methyl-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 57026799 |
| Molecular Formula | C27H27N3O7S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | ethyl 3-[2-(2-methoxy-2-phenylacetyl)oxyethyl]-6-methyl-4-(3-nitrophenyl)-4,5-dihydro-[1,2]thiazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1C(C)=Nc2snc(CCOC(=O)C(OC)c3ccccc3)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H27N3O7S/c1-4-36-26(31)21-16(2)28-25-23(22(21)18-11-8-12-19(15-18)30(33)34)20(29-38-25)13-14-37-27(32)24(35-3)17-9-6-5-7-10-17/h5-12,15,21-22,24H,4,13-14H2,1-3H3 |
| InChIKey | UZUWOQKLCXRXJD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 130.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|