C33H29F13N2O7 — CID 54297056
3-O-[(2S)-2-methoxy-2-phenylethyl] 5-O-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54297056) has the molecular formula C33H29F13N2O7 and a molecular weight of 812.58 g/mol. Its IUPAC name is 3-O-[(2S)-2-methoxy-2-phenylethyl] 5-O-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[(2S)-2-methoxy-2-phenylethyl] 5-O-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54297056 |
| Molecular Formula | C33H29F13N2O7 |
| Molecular Weight | 812.58 g/mol |
| Exact Mass | 812.18 |
| IUPAC Name | 3-O-[(2S)-2-methoxy-2-phenylethyl] 5-O-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CO[C@H](COC(=O)C1C(C)=NC(C)=C(C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C33H29F13N2O7/c1-17-23(26(49)54-14-8-13-28(34,35)29(36,37)30(38,39)31(40,41)32(42,43)33(44,45)46)25(20-11-7-12-21(15-20)48(51)52)24(18(2)47-17)27(50)55-16-22(53-3)19-9-5-4-6-10-19/h4-7,9-12,15,22,24-25H,8,13-14,16H2,1-3H3/t22-,24?,25?/m1/s1 |
| InChIKey | SBNBGOSWXFOKLA-PBGLPUTKSA-N |
| XLogP | 9.04 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.58 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|