C15H13N3O2 — CID 57181140
3-[2-(4-methoxyphenyl)ethynyl]-4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ol (PubChem CID 57181140) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethynyl]-4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ol.
| Compound Name | 3-[2-(4-methoxyphenyl)ethynyl]-4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ol |
|---|---|
| PubChem CID | 57181140 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethynyl]-4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ol |
| SMILES | COc1ccc(C#CN2C=Nc3[nH]ccc3C2O)cc1 |
| InChI | InChI=1S/C15H13N3O2/c1-20-12-4-2-11(3-5-12)7-9-18-10-17-14-13(15(18)19)6-8-16-14/h2-6,8,10,15-16,19H,1H3 |
| InChIKey | CUYOQXRBEWQDLY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|