C15H20O5S — CID 57185898
5-methoxy-4-[1-(2-methylphenyl)sulfonylpropan-2-yl]oxolan-2-one (PubChem CID 57185898) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-methoxy-4-[1-(2-methylphenyl)sulfonylpropan-2-yl]oxolan-2-one.
| Compound Name | 5-methoxy-4-[1-(2-methylphenyl)sulfonylpropan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 57185898 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 5-methoxy-4-[1-(2-methylphenyl)sulfonylpropan-2-yl]oxolan-2-one |
| SMILES | COC1OC(=O)CC1C(C)CS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C15H20O5S/c1-10-6-4-5-7-13(10)21(17,18)9-11(2)12-8-14(16)20-15(12)19-3/h4-7,11-12,15H,8-9H2,1-3H3 |
| InChIKey | MJOTUSMGSPJEMA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |