C5H7ClN2O2 — CID 57186276
1-chloro-5,6-dihydro-4H-pyrimidine-5-carboxylic acid (PubChem CID 57186276) has the molecular formula C5H7ClN2O2 and a molecular weight of 162.58 g/mol. Its IUPAC name is 1-chloro-5,6-dihydro-4H-pyrimidine-5-carboxylic acid.
| Compound Name | 1-chloro-5,6-dihydro-4H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 57186276 |
| Molecular Formula | C5H7ClN2O2 |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 1-chloro-5,6-dihydro-4H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)C1CN=CN(Cl)C1 |
| InChI | InChI=1S/C5H7ClN2O2/c6-8-2-4(5(9)10)1-7-3-8/h3-4H,1-2H2,(H,9,10) |
| InChIKey | VTVBEWSHYAXDBN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|