C30H38O6 — CID 57186513
2,2-bis(bicyclo[2.2.1]hept-2-ene-2-carbonyloxymethyl)butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (PubChem CID 57186513) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2,2-bis(bicyclo[2.2.1]hept-2-ene-2-carbonyloxymethyl)butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
| Compound Name | 2,2-bis(bicyclo[2.2.1]hept-2-ene-2-carbonyloxymethyl)butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 57186513 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2,2-bis(bicyclo[2.2.1]hept-2-ene-2-carbonyloxymethyl)butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| SMILES | CCC(COC(=O)C1=CC2CCC1C2)(COC(=O)C1=CC2CCC1C2)COC(=O)C1=CC2CCC1C2 |
| InChI | InChI=1S/C30H38O6/c1-2-30(15-34-27(31)24-12-18-3-6-21(24)9-18,16-35-28(32)25-13-19-4-7-22(25)10-19)17-36-29(33)26-14-20-5-8-23(26)11-20/h12-14,18-23H,2-11,15-17H2,1H3 |
| InChIKey | RKEVSJSHKKLELG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|