C16H18S2 — CID 57200216
2-[(2-ethylphenyl)disulfanyl]-1,3-dimethylbenzene (PubChem CID 57200216) has the molecular formula C16H18S2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-[(2-ethylphenyl)disulfanyl]-1,3-dimethylbenzene.
| Compound Name | 2-[(2-ethylphenyl)disulfanyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 57200216 |
| Molecular Formula | C16H18S2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[(2-ethylphenyl)disulfanyl]-1,3-dimethylbenzene |
| SMILES | CCc1ccccc1SSc1c(C)cccc1C |
| InChI | InChI=1S/C16H18S2/c1-4-14-10-5-6-11-15(14)17-18-16-12(2)8-7-9-13(16)3/h5-11H,4H2,1-3H3 |
| InChIKey | BMPJAISBCWPPEC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|