C17H20S2 — CID 57202834
1,3-diethyl-2-[(2-methylphenyl)disulfanyl]benzene (PubChem CID 57202834) has the molecular formula C17H20S2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1,3-diethyl-2-[(2-methylphenyl)disulfanyl]benzene.
| Compound Name | 1,3-diethyl-2-[(2-methylphenyl)disulfanyl]benzene |
|---|---|
| PubChem CID | 57202834 |
| Molecular Formula | C17H20S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1,3-diethyl-2-[(2-methylphenyl)disulfanyl]benzene |
| SMILES | CCc1cccc(CC)c1SSc1ccccc1C |
| InChI | InChI=1S/C17H20S2/c1-4-14-10-8-11-15(5-2)17(14)19-18-16-12-7-6-9-13(16)3/h6-12H,4-5H2,1-3H3 |
| InChIKey | MZTRPPCPNOMURD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|