C13H23NO2 — CID 57203553
3-methyl-4-octan-2-yl-1H-pyrrole-2,5-diol (PubChem CID 57203553) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-methyl-4-octan-2-yl-1H-pyrrole-2,5-diol.
| Compound Name | 3-methyl-4-octan-2-yl-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 57203553 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-methyl-4-octan-2-yl-1H-pyrrole-2,5-diol |
| SMILES | CCCCCCC(C)c1c(O)[nH]c(O)c1C |
| InChI | InChI=1S/C13H23NO2/c1-4-5-6-7-8-9(2)11-10(3)12(15)14-13(11)16/h9,14-16H,4-8H2,1-3H3 |
| InChIKey | YWWUTJNXRJGBHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|