C33H39N3O3S — CID 57210012
2-(1-benzothiophen-3-ylamino)-4-methyl-5-(2-pyrrolidin-1-ylethoxy)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenol (PubChem CID 57210012) has the molecular formula C33H39N3O3S and a molecular weight of 557.76 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylamino)-4-methyl-5-(2-pyrrolidin-1-ylethoxy)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenol.
| Compound Name | 2-(1-benzothiophen-3-ylamino)-4-methyl-5-(2-pyrrolidin-1-ylethoxy)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenol |
|---|---|
| PubChem CID | 57210012 |
| Molecular Formula | C33H39N3O3S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 2-(1-benzothiophen-3-ylamino)-4-methyl-5-(2-pyrrolidin-1-ylethoxy)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenol |
| SMILES | Cc1c(OCCN2CCCC2)cc(O)c(Nc2csc3ccccc23)c1-c1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C33H39N3O3S/c1-24-30(39-21-19-36-16-6-7-17-36)22-29(37)33(34-28-23-40-31-9-3-2-8-27(28)31)32(24)25-10-12-26(13-11-25)38-20-18-35-14-4-5-15-35/h2-3,8-13,22-23,34,37H,4-7,14-21H2,1H3 |
| InChIKey | DBNWHRWLBSNUEN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|