C15H16F5N3O2 — CID 57210041
2-(4-fluorophenyl)-3-methyl-4-(1,1,2,2-tetrafluoroethoxy)-1-(1H-1,2,4-triazol-5-yl)butan-2-ol (PubChem CID 57210041) has the molecular formula C15H16F5N3O2 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-methyl-4-(1,1,2,2-tetrafluoroethoxy)-1-(1H-1,2,4-triazol-5-yl)butan-2-ol.
| Compound Name | 2-(4-fluorophenyl)-3-methyl-4-(1,1,2,2-tetrafluoroethoxy)-1-(1H-1,2,4-triazol-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 57210041 |
| Molecular Formula | C15H16F5N3O2 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-(4-fluorophenyl)-3-methyl-4-(1,1,2,2-tetrafluoroethoxy)-1-(1H-1,2,4-triazol-5-yl)butan-2-ol |
| SMILES | CC(COC(F)(F)C(F)F)C(O)(Cc1ncn[nH]1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16F5N3O2/c1-9(7-25-15(19,20)13(17)18)14(24,6-12-21-8-22-23-12)10-2-4-11(16)5-3-10/h2-5,8-9,13,24H,6-7H2,1H3,(H,21,22,23) |
| InChIKey | WJHQQUKMXCUJPI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|