C12H10F4N4OS — CID 56995282
3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butanethioamide (PubChem CID 56995282) has the molecular formula C12H10F4N4OS and a molecular weight of 334.30 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butanethioamide.
| Compound Name | 3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butanethioamide |
|---|---|
| PubChem CID | 56995282 |
| Molecular Formula | C12H10F4N4OS |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butanethioamide |
| SMILES | NC(=S)C(F)(F)C(O)(Cc1ncn[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H10F4N4OS/c13-6-1-2-7(8(14)3-6)11(21,12(15,16)10(17)22)4-9-18-5-19-20-9/h1-3,5,21H,4H2,(H2,17,22)(H,18,19,20) |
| InChIKey | DRJFMZGDLTYHQM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|