C21H20F2N6OS — CID 67675327
3-[4-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]phenyl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 67675327) has the molecular formula C21H20F2N6OS and a molecular weight of 442.50 g/mol. Its IUPAC name is 3-[4-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]phenyl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]phenyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 67675327 |
| Molecular Formula | C21H20F2N6OS |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[4-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]phenyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | C[C@@H](c1ccc(-c2n[nH]c(=S)n2C)cc1)[C@](O)(Cc1ncn[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H20F2N6OS/c1-12(13-3-5-14(6-4-13)19-27-28-20(31)29(19)2)21(30,10-18-24-11-25-26-18)16-8-7-15(22)9-17(16)23/h3-9,11-12,30H,10H2,1-2H3,(H,28,31)(H,24,25,26)/t12-,21+/m0/s1 |
| InChIKey | BHECYHBUBJRTIC-LAJNKCICSA-N |
| XLogP | 3.77 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|