C21H29ClN2O — CID 57211691
5-[1-(4-chlorophenyl)ethenyl]-N-[3-(dimethylamino)propoxy]-3,3-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 57211691) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)ethenyl]-N-[3-(dimethylamino)propoxy]-3,3-dimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 5-[1-(4-chlorophenyl)ethenyl]-N-[3-(dimethylamino)propoxy]-3,3-dimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 57211691 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 5-[1-(4-chlorophenyl)ethenyl]-N-[3-(dimethylamino)propoxy]-3,3-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | C=C(C1=CC(NOCCCN(C)C)=CC(C)(C)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H29ClN2O/c1-16(17-7-9-19(22)10-8-17)18-13-20(15-21(2,3)14-18)23-25-12-6-11-24(4)5/h7-10,13,15,23H,1,6,11-12,14H2,2-5H3 |
| InChIKey | RKTXKWAAYXUQSY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|