C8H8N2 — CID 57218159
6,6a-dihydropentalene-1,5-diimine (PubChem CID 57218159) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 6,6a-dihydropentalene-1,5-diimine.
| Compound Name | 6,6a-dihydropentalene-1,5-diimine |
|---|---|
| PubChem CID | 57218159 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 6,6a-dihydropentalene-1,5-diimine |
| SMILES | [H]/N=C1\C=C2C=C/C(=N\[H])C2C1 |
| InChI | InChI=1S/C8H8N2/c9-6-3-5-1-2-8(10)7(5)4-6/h1-3,7,9-10H,4H2/b9-6+,10-8+ |
| InChIKey | JAEITPRJOJOQQO-OAMUUVBCSA-N |
| XLogP | 1.54 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|