C9H15NO3 — CID 57221099
3-[2-(1-hydroxyethyl)-1H-pyrrol-3-yl]propane-1,2-diol (PubChem CID 57221099) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-[2-(1-hydroxyethyl)-1H-pyrrol-3-yl]propane-1,2-diol.
| Compound Name | 3-[2-(1-hydroxyethyl)-1H-pyrrol-3-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 57221099 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-[2-(1-hydroxyethyl)-1H-pyrrol-3-yl]propane-1,2-diol |
| SMILES | CC(O)c1[nH]ccc1CC(O)CO |
| InChI | InChI=1S/C9H15NO3/c1-6(12)9-7(2-3-10-9)4-8(13)5-11/h2-3,6,8,10-13H,4-5H2,1H3 |
| InChIKey | ONZBUGAFYWORJJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |