C19H29N3O4 — CID 57224249
methyl (3S)-4-[4-(aminomethyl)piperidin-1-yl]-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 57224249) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is methyl (3S)-4-[4-(aminomethyl)piperidin-1-yl]-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (3S)-4-[4-(aminomethyl)piperidin-1-yl]-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 57224249 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | methyl (3S)-4-[4-(aminomethyl)piperidin-1-yl]-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C[C@@H](CN1CCC(CN)CC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29N3O4/c1-25-18(23)11-17(13-22-9-7-15(12-20)8-10-22)21-19(24)26-14-16-5-3-2-4-6-16/h2-6,15,17H,7-14,20H2,1H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | VDMZYXYUTVHUQM-KRWDZBQOSA-N |
| XLogP | 1.52 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |