C8H8Cl2FN3 — CID 57224615
1-(2,6-dichloro-4-fluorophenyl)-1-methylguanidine (PubChem CID 57224615) has the molecular formula C8H8Cl2FN3 and a molecular weight of 236.08 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-fluorophenyl)-1-methylguanidine.
| Compound Name | 1-(2,6-dichloro-4-fluorophenyl)-1-methylguanidine |
|---|---|
| PubChem CID | 57224615 |
| Molecular Formula | C8H8Cl2FN3 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 1-(2,6-dichloro-4-fluorophenyl)-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C8H8Cl2FN3/c1-14(8(12)13)7-5(9)2-4(11)3-6(7)10/h2-3H,1H3,(H3,12,13) |
| InChIKey | NYSGQZSJXLKLQX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|