C12H10ClF3N2O2 — CID 57228366
N-[2-[(7-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 57228366) has the molecular formula C12H10ClF3N2O2 and a molecular weight of 306.67 g/mol. Its IUPAC name is N-[2-[(7-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[(7-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57228366 |
| Molecular Formula | C12H10ClF3N2O2 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-[2-[(7-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCOc1ccc(Cl)c2[nH]ccc12)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2O2/c13-8-1-2-9(7-3-4-17-10(7)8)20-6-5-18-11(19)12(14,15)16/h1-4,17H,5-6H2,(H,18,19) |
| InChIKey | NBDWWSXGBUDWGI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|