C12H22N2O4S — CID 57229239
[(2S)-2-amino-4-methylsulfanylbutanoyl] (2S)-2-formamido-4-methylpentanoate (PubChem CID 57229239) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is [(2S)-2-amino-4-methylsulfanylbutanoyl] (2S)-2-formamido-4-methylpentanoate.
| Compound Name | [(2S)-2-amino-4-methylsulfanylbutanoyl] (2S)-2-formamido-4-methylpentanoate |
|---|---|
| PubChem CID | 57229239 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(2S)-2-amino-4-methylsulfanylbutanoyl] (2S)-2-formamido-4-methylpentanoate |
| SMILES | CSCC[C@H](N)C(=O)OC(=O)[C@H](CC(C)C)NC=O |
| InChI | InChI=1S/C12H22N2O4S/c1-8(2)6-10(14-7-15)12(17)18-11(16)9(13)4-5-19-3/h7-10H,4-6,13H2,1-3H3,(H,14,15)/t9-,10-/m0/s1 |
| InChIKey | CGCKAXNNXKKYJR-UWVGGRQHSA-N |
| XLogP | 0.30 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|